About 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan
4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan (PubChem CID 100968646) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan.
Molecular Properties
| Compound Name | 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan |
| PubChem CID | 100968646 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan |
| SMILES | CC(C)(C)C1=C(C#Cc2ccccc2)OCC1(C)C |
| InChI | InChI=1S/C18H22O/c1-17(2,3)16-15(19-13-18(16,4)5)12-11-14-9-7-6-8-10-14/h6-10H,13H2,1-5H3 |
| InChIKey | OOACYKRWKAMQNX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan?
The IUPAC name of 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan (CID 100968646) is 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan.
What is the SMILES notation for 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan?
The canonical SMILES for 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan is CC(C)(C)C1=C(C#Cc2ccccc2)OCC1(C)C.
What is the InChIKey of 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan?
The InChIKey is OOACYKRWKAMQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-17(2,3)16-15(19-13-18(16,4)5)12-11-14-9-7-6-8-10-14/h6-10H,13H2,1-5H3.
What are the key properties of 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan?
4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan has a molecular weight of 254.37 g/mol, XLogP of 4.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,3-dimethyl-5-(2-phenylethynyl)-2H-furan is sourced from PubChem (CID 100968646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).