C7H13N3O5 — CID 100968710
1-carbamoyl-3-[(2S,4S,5S)-4,5-dihydroxyoxan-2-yl]urea (PubChem CID 100968710) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is 1-carbamoyl-3-[(2S,4S,5S)-4,5-dihydroxyoxan-2-yl]urea.
| Compound Name | 1-carbamoyl-3-[(2S,4S,5S)-4,5-dihydroxyoxan-2-yl]urea |
|---|---|
| PubChem CID | 100968710 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-carbamoyl-3-[(2S,4S,5S)-4,5-dihydroxyoxan-2-yl]urea |
| SMILES | NC(=O)NC(=O)N[C@@H]1C[C@H](O)[C@@H](O)CO1 |
| InChI | InChI=1S/C7H13N3O5/c8-6(13)10-7(14)9-5-1-3(11)4(12)2-15-5/h3-5,11-12H,1-2H2,(H4,8,9,10,13,14)/t3-,4-,5-/m0/s1 |
| InChIKey | YEHOWVOKNBCKCU-YUPRTTJUSA-N |
| XLogP | -2.17 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |