C22H24O4S — CID 100968737
(1R,2R,7S,8S)-4-methoxy-2-(4-methylphenyl)sulfinyl-5-propan-2-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 100968737) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is (1R,2R,7S,8S)-4-methoxy-2-(4-methylphenyl)sulfinyl-5-propan-2-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2R,7S,8S)-4-methoxy-2-(4-methylphenyl)sulfinyl-5-propan-2-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 100968737 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (1R,2R,7S,8S)-4-methoxy-2-(4-methylphenyl)sulfinyl-5-propan-2-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | COC1=C(C(C)C)C(=O)[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]2(S(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C22H24O4S/c1-12(2)17-19(23)18-14-7-8-15(11-14)22(18,21(24)20(17)26-4)27(25)16-9-5-13(3)6-10-16/h5-10,12,14-15,18H,11H2,1-4H3/t14-,15+,18+,22-,27?/m1/s1 |
| InChIKey | UAXKQPZGNPZFOC-NQWHGDSESA-N |
| XLogP | 3.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|