C10H15N3O5 — CID 100968870
methyl (2S)-4-methyl-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)pentanoate (PubChem CID 100968870) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)pentanoate |
|---|---|
| PubChem CID | 100968870 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | methyl (2S)-4-methyl-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O5/c1-5(2)4-6(7(14)18-3)13-9(16)11-8(15)12-10(13)17/h5-6H,4H2,1-3H3,(H2,11,12,15,16,17)/t6-/m0/s1 |
| InChIKey | PMXAVAJKKJSBDY-LURJTMIESA-N |
| XLogP | -1.01 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |