C25H38O6S2 — CID 100969015
(1R,10aR)-1,4a-dimethyl-7-propan-2-yl-9-(5-sulfanylpentoxy)-6-sulfo-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 100969015) has the molecular formula C25H38O6S2 and a molecular weight of 498.71 g/mol. Its IUPAC name is (1R,10aR)-1,4a-dimethyl-7-propan-2-yl-9-(5-sulfanylpentoxy)-6-sulfo-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,10aR)-1,4a-dimethyl-7-propan-2-yl-9-(5-sulfanylpentoxy)-6-sulfo-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 100969015 |
| Molecular Formula | C25H38O6S2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (1R,10aR)-1,4a-dimethyl-7-propan-2-yl-9-(5-sulfanylpentoxy)-6-sulfo-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1S(=O)(=O)O)C1(C)CCC[C@@](C)(C(=O)O)[C@@H]1CC2OCCCCCS |
| InChI | InChI=1S/C25H38O6S2/c1-16(2)17-13-18-19(14-21(17)33(28,29)30)24(3)9-8-10-25(4,23(26)27)22(24)15-20(18)31-11-6-5-7-12-32/h13-14,16,20,22,32H,5-12,15H2,1-4H3,(H,26,27)(H,28,29,30)/t20?,22-,24?,25-/m1/s1 |
| InChIKey | QUECPEWNUNKYAK-YURUHWHTSA-N |
| XLogP | 5.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|