C20H20O4S — CID 100969044
(1S,3S,6R,8R)-8-hydroxy-3-methyl-10-(naphthalen-2-ylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one (PubChem CID 100969044) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is (1S,3S,6R,8R)-8-hydroxy-3-methyl-10-(naphthalen-2-ylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one.
| Compound Name | (1S,3S,6R,8R)-8-hydroxy-3-methyl-10-(naphthalen-2-ylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one |
|---|---|
| PubChem CID | 100969044 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (1S,3S,6R,8R)-8-hydroxy-3-methyl-10-(naphthalen-2-ylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one |
| SMILES | C[C@]12CC(=O)[C@@H]3C[C@@]1(O)O[C@H](O2)C3CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H20O4S/c1-19-10-17(21)15-9-20(19,22)24-18(23-19)16(15)11-25-14-7-6-12-4-2-3-5-13(12)8-14/h2-8,15-16,18,22H,9-11H2,1H3/t15-,16?,18+,19+,20-/m1/s1 |
| InChIKey | FWDWOOQUVYRKDJ-XEUDDIOWSA-N |
| XLogP | 3.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |