C13H16O5 — CID 100969480
9,9-dimethoxy-10-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione (PubChem CID 100969480) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 9,9-dimethoxy-10-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione.
| Compound Name | 9,9-dimethoxy-10-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
|---|---|
| PubChem CID | 100969480 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 9,9-dimethoxy-10-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
| SMILES | COC1(OC)C(=O)C2C=C(C)C1C1OC(=O)CC21 |
| InChI | InChI=1S/C13H16O5/c1-6-4-8-7-5-9(14)18-11(7)10(6)13(16-2,17-3)12(8)15/h4,7-8,10-11H,5H2,1-3H3 |
| InChIKey | ZODTXCBUJQAQLD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|