C8H14O7S3 — CID 100969485
[(1R,5S,6R,7R)-7-methylsulfonyloxy-8-oxa-3-thiabicyclo[3.2.1]octan-6-yl] methanesulfonate (PubChem CID 100969485) has the molecular formula C8H14O7S3 and a molecular weight of 318.39 g/mol. Its IUPAC name is [(1R,5S,6R,7R)-7-methylsulfonyloxy-8-oxa-3-thiabicyclo[3.2.1]octan-6-yl] methanesulfonate.
| Compound Name | [(1R,5S,6R,7R)-7-methylsulfonyloxy-8-oxa-3-thiabicyclo[3.2.1]octan-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 100969485 |
| Molecular Formula | C8H14O7S3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | [(1R,5S,6R,7R)-7-methylsulfonyloxy-8-oxa-3-thiabicyclo[3.2.1]octan-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1[C@H](OS(C)(=O)=O)[C@H]2CSC[C@@H]1O2 |
| InChI | InChI=1S/C8H14O7S3/c1-17(9,10)14-7-5-3-16-4-6(13-5)8(7)15-18(2,11)12/h5-8H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | ZVCDTUDTLGSZDB-ULAWRXDQSA-N |
| XLogP | -0.81 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|