C28H50ClNO2Si — CID 100969512
chloro-dimethyl-[9-[2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]nonyl]silane (PubChem CID 100969512) has the molecular formula C28H50ClNO2Si and a molecular weight of 496.25 g/mol. Its IUPAC name is chloro-dimethyl-[9-[2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]nonyl]silane.
| Compound Name | chloro-dimethyl-[9-[2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]nonyl]silane |
|---|---|
| PubChem CID | 100969512 |
| Molecular Formula | C28H50ClNO2Si |
| Molecular Weight | 496.25 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | chloro-dimethyl-[9-[2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]nonyl]silane |
| SMILES | CC1(C)CCCC(C)(C)N1OC(COCCCCCCCCC[Si](C)(C)Cl)c1ccccc1 |
| InChI | InChI=1S/C28H50ClNO2Si/c1-27(2)20-17-21-28(3,4)30(27)32-26(25-18-13-12-14-19-25)24-31-22-15-10-8-7-9-11-16-23-33(5,6)29/h12-14,18-19,26H,7-11,15-17,20-24H2,1-6H3 |
| InChIKey | FGORZTNXPYMIAP-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.25 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|