C24H45F2NSi2 — CID 100969946
1,3,5-tritert-butyl-2-[[[tert-butyl(dimethyl)silyl]amino]-difluorosilyl]benzene (PubChem CID 100969946) has the molecular formula C24H45F2NSi2 and a molecular weight of 441.80 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-2-[[[tert-butyl(dimethyl)silyl]amino]-difluorosilyl]benzene.
| Compound Name | 1,3,5-tritert-butyl-2-[[[tert-butyl(dimethyl)silyl]amino]-difluorosilyl]benzene |
|---|---|
| PubChem CID | 100969946 |
| Molecular Formula | C24H45F2NSi2 |
| Molecular Weight | 441.80 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 1,3,5-tritert-butyl-2-[[[tert-butyl(dimethyl)silyl]amino]-difluorosilyl]benzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([Si](F)(F)N[Si](C)(C)C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H45F2NSi2/c1-21(2,3)17-15-18(22(4,5)6)20(19(16-17)23(7,8)9)29(25,26)27-28(13,14)24(10,11)12/h15-16,27H,1-14H3 |
| InChIKey | HPCGJYXRNLHBIW-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.80 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|