C9H18NO — CID 100970186
2,2,6,6-Tetramethylpiperidine-d18-1-oxyl (PubChem CID 100970186) has the molecular formula C9H18NO and a molecular weight of 174.36 g/mol.
| Compound Name | 2,2,6,6-Tetramethylpiperidine-d18-1-oxyl |
|---|---|
| PubChem CID | 100970186 |
| Molecular Formula | C9H18NO |
| Molecular Weight | 174.36 g/mol |
| Exact Mass | 174.25 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])N([O])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C9H18NO/c1-8(2)6-5-7-9(3,4)10(8)11/h5-7H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,7D2 |
| InChIKey | QYTDEUPAUMOIOP-UWBLXWIRSA-N |
| XLogP | 2.38 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |