C22H36O6P2 — CID 100970985
(1R,3S,5S,7R)-1,3,5,7-tetramethyl-8-[2-[(1R,3S,5S,7R)-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl]ethyl]-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane (PubChem CID 100970985) has the molecular formula C22H36O6P2 and a molecular weight of 458.47 g/mol. Its IUPAC name is (1R,3S,5S,7R)-1,3,5,7-tetramethyl-8-[2-[(1R,3S,5S,7R)-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl]ethyl]-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane.
| Compound Name | (1R,3S,5S,7R)-1,3,5,7-tetramethyl-8-[2-[(1R,3S,5S,7R)-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl]ethyl]-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 100970985 |
| Molecular Formula | C22H36O6P2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (1R,3S,5S,7R)-1,3,5,7-tetramethyl-8-[2-[(1R,3S,5S,7R)-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl]ethyl]-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
| SMILES | C[C@@]12C[C@]3(C)O[C@@](C)(C[C@](C)(O1)P3CCP1[C@]3(C)C[C@@]4(C)O[C@](C)(C[C@]1(C)O4)O3)O2 |
| InChI | InChI=1S/C22H36O6P2/c1-15-11-19(5)26-16(2,23-15)12-20(6,25-15)29(19)9-10-30-21(7)13-17(3)24-18(4,28-21)14-22(30,8)27-17/h9-14H2,1-8H3/t15-,16-,17-,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | PTPFVHYOOBNNAM-YRIMVJGQSA-N |
| XLogP | 5.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|