C32H53N3O2 — CID 100971553
[(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-azido-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 100971553) has the molecular formula C32H53N3O2 and a molecular weight of 511.80 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-azido-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-azido-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 100971553 |
| Molecular Formula | C32H53N3O2 |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 511.41 |
| IUPAC Name | [(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-azido-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3=C(CC[C@H]2C1(C)C)[C@]1(C)CC[C@H]([C@H](C)CCCC(C)(C)N=[N+]=[N-])[C@@]1(C)CC3 |
| InChI | InChI=1S/C32H53N3O2/c1-21(11-10-17-28(3,4)34-35-33)23-14-19-32(9)25-12-13-26-29(5,6)27(37-22(2)36)16-18-30(26,7)24(25)15-20-31(23,32)8/h21,23,26-27H,10-20H2,1-9H3/t21-,23-,26+,27+,30-,31-,32+/m1/s1 |
| InChIKey | ZKLWQVYMQQQAGD-RDXQEYJHSA-N |
| XLogP | 9.56 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|