C31H45N3O2 — CID 10097159
N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-3,7-dimethyloct-6-enamide (PubChem CID 10097159) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-3,7-dimethyloct-6-enamide.
| Compound Name | N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-3,7-dimethyloct-6-enamide |
|---|---|
| PubChem CID | 10097159 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-3,7-dimethyloct-6-enamide |
| SMILES | CC(C)=CCCC(C)CC(=O)NC(CNC(=O)Nc1c(C(C)C)cccc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C31H45N3O2/c1-21(2)13-11-14-24(7)19-29(35)33-28(25-15-9-8-10-16-25)20-32-31(36)34-30-26(22(3)4)17-12-18-27(30)23(5)6/h8-10,12-13,15-18,22-24,28H,11,14,19-20H2,1-7H3,(H,33,35)(H2,32,34,36) |
| InChIKey | UDKPHCIJEBYGKN-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|