C16H22N2O — CID 100971597
(2S)-2-cyano-3,3-dimethyl-N-(3-phenylpropyl)butanamide (PubChem CID 100971597) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (2S)-2-cyano-3,3-dimethyl-N-(3-phenylpropyl)butanamide.
| Compound Name | (2S)-2-cyano-3,3-dimethyl-N-(3-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 100971597 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2S)-2-cyano-3,3-dimethyl-N-(3-phenylpropyl)butanamide |
| SMILES | CC(C)(C)[C@@H](C#N)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c1-16(2,3)14(12-17)15(19)18-11-7-10-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-11H2,1-3H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | NQTLVOZBUNWPRM-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|