C21H25NO5 — CID 100971867
diethyl (1S,5R,7R,11S)-5-phenyl-2-oxa-3-azatricyclo[5.3.1.04,11]undec-3-ene-6,6-dicarboxylate (PubChem CID 100971867) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is diethyl (1S,5R,7R,11S)-5-phenyl-2-oxa-3-azatricyclo[5.3.1.04,11]undec-3-ene-6,6-dicarboxylate.
| Compound Name | diethyl (1S,5R,7R,11S)-5-phenyl-2-oxa-3-azatricyclo[5.3.1.04,11]undec-3-ene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 100971867 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | diethyl (1S,5R,7R,11S)-5-phenyl-2-oxa-3-azatricyclo[5.3.1.04,11]undec-3-ene-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccccc2)C2=NO[C@H]3CCC[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C21H25NO5/c1-3-25-19(23)21(20(24)26-4-2)14-11-8-12-15-16(14)18(22-27-15)17(21)13-9-6-5-7-10-13/h5-7,9-10,14-17H,3-4,8,11-12H2,1-2H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | ATHDZOJILXEWAN-TWMKSMIVSA-N |
| XLogP | 3.07 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|