About (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol
(6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol (PubChem CID 100971905) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol.
Molecular Properties
| Compound Name | (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol |
| PubChem CID | 100971905 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol |
| SMILES | C/C=C/C=C\C#CC(C)(O)CCOC1CCCCO1 |
| InChI | InChI=1S/C16H24O3/c1-3-4-5-6-8-11-16(2,17)12-14-19-15-10-7-9-13-18-15/h3-6,15,17H,7,9-10,12-14H2,1-2H3/b4-3+,6-5- |
| InChIKey | SDZRNUAYPHCSPG-ICWBMWKASA-N |
| XLogP | 2.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol?
The IUPAC name of (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol (CID 100971905) is (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol.
What is the SMILES notation for (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol?
The canonical SMILES for (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol is C/C=C/C=C\C#CC(C)(O)CCOC1CCCCO1.
What is the InChIKey of (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol?
The InChIKey is SDZRNUAYPHCSPG-ICWBMWKASA-N. The full InChI is InChI=1S/C16H24O3/c1-3-4-5-6-8-11-16(2,17)12-14-19-15-10-7-9-13-18-15/h3-6,15,17H,7,9-10,12-14H2,1-2H3/b4-3+,6-5-.
What are the key properties of (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol?
(6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol has a molecular weight of 264.37 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,8E)-3-methyl-1-(oxan-2-yloxy)deca-6,8-dien-4-yn-3-ol is sourced from PubChem (CID 100971905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).