C12H24Si — CID 100972374
triethyl-[(1E)-3-methylpenta-1,4-dienyl]silane (PubChem CID 100972374) has the molecular formula C12H24Si and a molecular weight of 196.41 g/mol. Its IUPAC name is triethyl-[(1E)-3-methylpenta-1,4-dienyl]silane.
| Compound Name | triethyl-[(1E)-3-methylpenta-1,4-dienyl]silane |
|---|---|
| PubChem CID | 100972374 |
| Molecular Formula | C12H24Si |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | triethyl-[(1E)-3-methylpenta-1,4-dienyl]silane |
| SMILES | C=CC(C)/C=C/[Si](CC)(CC)CC |
| InChI | InChI=1S/C12H24Si/c1-6-12(5)10-11-13(7-2,8-3)9-4/h6,10-12H,1,7-9H2,2-5H3/b11-10+ |
| InChIKey | GYKRQGSBGZUAEJ-ZHACJKMWSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|