C7H6F6S — CID 100972382
(1Z,3E)-5,5,5-trifluoro-1-methylsulfanyl-2-(trifluoromethyl)penta-1,3-diene (PubChem CID 100972382) has the molecular formula C7H6F6S and a molecular weight of 236.18 g/mol. Its IUPAC name is (1Z,3E)-5,5,5-trifluoro-1-methylsulfanyl-2-(trifluoromethyl)penta-1,3-diene.
| Compound Name | (1Z,3E)-5,5,5-trifluoro-1-methylsulfanyl-2-(trifluoromethyl)penta-1,3-diene |
|---|---|
| PubChem CID | 100972382 |
| Molecular Formula | C7H6F6S |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (1Z,3E)-5,5,5-trifluoro-1-methylsulfanyl-2-(trifluoromethyl)penta-1,3-diene |
| SMILES | CS/C=C(/C=C/C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6S/c1-14-4-5(7(11,12)13)2-3-6(8,9)10/h2-4H,1H3/b3-2+,5-4- |
| InChIKey | PNZGXRMCJBPOOF-IAROGAJJSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|