C39H70O8 — CID 100973139
(2S)-4-[(2R,13R)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S,4S)-1,4-dihydroxytridecyl]oxolan-2-yl]oxolan-2-yl]-2,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one (PubChem CID 100973139) has the molecular formula C39H70O8 and a molecular weight of 666.98 g/mol. Its IUPAC name is (2S)-4-[(2R,13R)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S,4S)-1,4-dihydroxytridecyl]oxolan-2-yl]oxolan-2-yl]-2,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(2R,13R)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S,4S)-1,4-dihydroxytridecyl]oxolan-2-yl]oxolan-2-yl]-2,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 100973139 |
| Molecular Formula | C39H70O8 |
| Molecular Weight | 666.98 g/mol |
| Exact Mass | 666.51 |
| IUPAC Name | (2S)-4-[(2R,13R)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S,4S)-1,4-dihydroxytridecyl]oxolan-2-yl]oxolan-2-yl]-2,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCCC[C@H](O)CC[C@H](O)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@H](O)CCCCCCCCCC[C@@H](O)CC3=C[C@H](C)OC3=O)O2)O1 |
| InChI | InChI=1S/C39H70O8/c1-3-4-5-6-9-12-15-18-31(40)21-22-34(43)36-24-26-38(47-36)37-25-23-35(46-37)33(42)20-17-14-11-8-7-10-13-16-19-32(41)28-30-27-29(2)45-39(30)44/h27,29,31-38,40-43H,3-26,28H2,1-2H3/t29-,31-,32+,33+,34-,35+,36+,37+,38+/m0/s1 |
| InChIKey | GLIXEIRMTDIPLZ-JGDYCLPLSA-N |
| XLogP | 7.61 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.98 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|