C22H30O — CID 100973622
(E)-4-(4-methylphenyl)-1-[(1R,2S)-2-[(2E)-penta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-ol (PubChem CID 100973622) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is (E)-4-(4-methylphenyl)-1-[(1R,2S)-2-[(2E)-penta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-ol.
| Compound Name | (E)-4-(4-methylphenyl)-1-[(1R,2S)-2-[(2E)-penta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 100973622 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (E)-4-(4-methylphenyl)-1-[(1R,2S)-2-[(2E)-penta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-ol |
| SMILES | C=C/C=C(\C)[C@H]1CCCC[C@@H]1CC(O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30O/c1-4-7-18(3)22-9-6-5-8-20(22)16-21(23)15-14-19-12-10-17(2)11-13-19/h4,7,10-15,20-23H,1,5-6,8-9,16H2,2-3H3/b15-14+,18-7+/t20-,21?,22-/m1/s1 |
| InChIKey | CBPQMTPEDKUECT-WCIPPEKESA-N |
| XLogP | 5.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|