C25H36F6O3 — CID 10097413
trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3S)-2,2,3-trimethyl-3-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexyl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol (PubChem CID 10097413) has the molecular formula C25H36F6O3 and a molecular weight of 498.55 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3S)-2,2,3-trimethyl-3-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexyl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3S)-2,2,3-trimethyl-3-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexyl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 10097413 |
| Molecular Formula | C25H36F6O3 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3S)-2,2,3-trimethyl-3-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexyl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C\[C@@H]2CC[C@](C)(CCCCC(O)(C(F)(F)F)C(F)(F)F)C2(C)C)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H36F6O3/c1-16-17(14-19(32)15-20(16)33)8-7-9-18-10-13-22(4,21(18,2)3)11-5-6-12-23(34,24(26,27)28)25(29,30)31/h7-9,18-20,32-34H,1,5-6,10-15H2,2-4H3/b9-7+,17-8-/t18-,19-,20+,22+/m1/s1 |
| InChIKey | LQOCIXVZVLMHSV-OVNROOLDSA-N |
| XLogP | 6.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|