About N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide
N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 100974416) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide |
| PubChem CID | 100974416 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC(=O)N[C@@]12CC[C@@H](C1)C(C)(C)C2=O |
| InChI | InChI=1S/C11H17NO2/c1-7(13)12-11-5-4-8(6-11)10(2,3)9(11)14/h8H,4-6H2,1-3H3,(H,12,13)/t8-,11-/m0/s1 |
| InChIKey | PZVLQNSIZXMJGA-KWQFWETISA-N |
| XLogP | 1.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide?
The IUPAC name of N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide (CID 100974416) is N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide.
What is the SMILES notation for N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide?
The canonical SMILES for N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide is CC(=O)N[C@@]12CC[C@@H](C1)C(C)(C)C2=O.
What is the InChIKey of N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide?
The InChIKey is PZVLQNSIZXMJGA-KWQFWETISA-N. The full InChI is InChI=1S/C11H17NO2/c1-7(13)12-11-5-4-8(6-11)10(2,3)9(11)14/h8H,4-6H2,1-3H3,(H,12,13)/t8-,11-/m0/s1.
What are the key properties of N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide?
N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide has a molecular weight of 195.26 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,4S)-3,3-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]acetamide is sourced from PubChem (CID 100974416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).