C15H20O3 — CID 100974493
(1S,2Z,10R,11S)-11-(hydroxymethyl)-11-methyl-7-methylidene-6-oxobicyclo[8.1.0]undec-2-ene-3-carbaldehyde (PubChem CID 100974493) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,2Z,10R,11S)-11-(hydroxymethyl)-11-methyl-7-methylidene-6-oxobicyclo[8.1.0]undec-2-ene-3-carbaldehyde.
| Compound Name | (1S,2Z,10R,11S)-11-(hydroxymethyl)-11-methyl-7-methylidene-6-oxobicyclo[8.1.0]undec-2-ene-3-carbaldehyde |
|---|---|
| PubChem CID | 100974493 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,2Z,10R,11S)-11-(hydroxymethyl)-11-methyl-7-methylidene-6-oxobicyclo[8.1.0]undec-2-ene-3-carbaldehyde |
| SMILES | C=C1CC[C@@H]2[C@H](/C=C(\C=O)CCC1=O)[C@@]2(C)CO |
| InChI | InChI=1S/C15H20O3/c1-10-3-5-12-13(15(12,2)9-17)7-11(8-16)4-6-14(10)18/h7-8,12-13,17H,1,3-6,9H2,2H3/b11-7-/t12-,13+,15+/m1/s1 |
| InChIKey | DSSKHUXSDPLUFL-GVGGZLBUSA-N |
| XLogP | 2.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|