C15H22O3 — CID 100974494
(1R,4R,6R,9Z,11S,12S)-12-(hydroxymethyl)-4,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-9-carbaldehyde (PubChem CID 100974494) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,4R,6R,9Z,11S,12S)-12-(hydroxymethyl)-4,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-9-carbaldehyde.
| Compound Name | (1R,4R,6R,9Z,11S,12S)-12-(hydroxymethyl)-4,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-9-carbaldehyde |
|---|---|
| PubChem CID | 100974494 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,4R,6R,9Z,11S,12S)-12-(hydroxymethyl)-4,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-9-carbaldehyde |
| SMILES | C[C@]1(CO)[C@@H]2CC[C@@]3(C)O[C@@H]3CC/C(C=O)=C/[C@@H]21 |
| InChI | InChI=1S/C15H22O3/c1-14(9-17)11-5-6-15(2)13(18-15)4-3-10(8-16)7-12(11)14/h7-8,11-13,17H,3-6,9H2,1-2H3/b10-7-/t11-,12+,13-,14+,15-/m1/s1 |
| InChIKey | AELSZYYNQJBBIG-OJUBKRKKSA-N |
| XLogP | 2.09 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|