C16H20O3S — CID 100974761
(3aS,4S,7aR)-4-(benzenesulfonyl)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one (PubChem CID 100974761) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is (3aS,4S,7aR)-4-(benzenesulfonyl)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one.
| Compound Name | (3aS,4S,7aR)-4-(benzenesulfonyl)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 100974761 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3aS,4S,7aR)-4-(benzenesulfonyl)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one |
| SMILES | C[C@@]12CCC[C@H](S(=O)(=O)c3ccccc3)[C@H]1CCC2=O |
| InChI | InChI=1S/C16H20O3S/c1-16-11-5-8-14(13(16)9-10-15(16)17)20(18,19)12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-11H2,1H3/t13-,14+,16-/m1/s1 |
| InChIKey | VFMUWARKRABSIW-IJEWVQPXSA-N |
| XLogP | 3.00 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |