About (4R)-4,8-dimethylnon-7-en-1-yne
(4R)-4,8-dimethylnon-7-en-1-yne (PubChem CID 100975019) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is (4R)-4,8-dimethylnon-7-en-1-yne.
Molecular Properties
| Compound Name | (4R)-4,8-dimethylnon-7-en-1-yne |
| PubChem CID | 100975019 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (4R)-4,8-dimethylnon-7-en-1-yne |
| SMILES | C#CC[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C11H18/c1-5-7-11(4)9-6-8-10(2)3/h1,8,11H,6-7,9H2,2-4H3/t11-/m0/s1 |
| InChIKey | BDRLOYHDMFFLRL-NSHDSACASA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4,8-dimethylnon-7-en-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,8-dimethylnon-7-en-1-yne?
The IUPAC name of (4R)-4,8-dimethylnon-7-en-1-yne (CID 100975019) is (4R)-4,8-dimethylnon-7-en-1-yne.
What is the SMILES notation for (4R)-4,8-dimethylnon-7-en-1-yne?
The canonical SMILES for (4R)-4,8-dimethylnon-7-en-1-yne is C#CC[C@H](C)CCC=C(C)C.
What is the InChIKey of (4R)-4,8-dimethylnon-7-en-1-yne?
The InChIKey is BDRLOYHDMFFLRL-NSHDSACASA-N. The full InChI is InChI=1S/C11H18/c1-5-7-11(4)9-6-8-10(2)3/h1,8,11H,6-7,9H2,2-4H3/t11-/m0/s1.
What are the key properties of (4R)-4,8-dimethylnon-7-en-1-yne?
(4R)-4,8-dimethylnon-7-en-1-yne has a molecular weight of 150.26 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,8-dimethylnon-7-en-1-yne is sourced from PubChem (CID 100975019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).