C17H22O2S — CID 100975064
(1S,2S,4R)-2-(benzenesulfonyl)-3-methylidene-2-propylbicyclo[2.2.1]heptane (PubChem CID 100975064) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is (1S,2S,4R)-2-(benzenesulfonyl)-3-methylidene-2-propylbicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4R)-2-(benzenesulfonyl)-3-methylidene-2-propylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 100975064 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (1S,2S,4R)-2-(benzenesulfonyl)-3-methylidene-2-propylbicyclo[2.2.1]heptane |
| SMILES | C=C1[C@@H]2CC[C@@H](C2)[C@]1(CCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O2S/c1-3-11-17(13(2)14-9-10-15(17)12-14)20(18,19)16-7-5-4-6-8-16/h4-8,14-15H,2-3,9-12H2,1H3/t14-,15+,17-/m1/s1 |
| InChIKey | GGNPVGHSNAQPBI-HLLBOEOZSA-N |
| XLogP | 3.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|