About (3S,5R)-3,5-dimethylpiperidin-4-one
(3S,5R)-3,5-dimethylpiperidin-4-one (PubChem CID 100975212) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethylpiperidin-4-one.
Molecular Properties
| Compound Name | (3S,5R)-3,5-dimethylpiperidin-4-one |
| PubChem CID | 100975212 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3S,5R)-3,5-dimethylpiperidin-4-one |
| SMILES | C[C@@H]1CNC[C@H](C)C1=O |
| InChI | InChI=1S/C7H13NO/c1-5-3-8-4-6(2)7(5)9/h5-6,8H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | AMGHHWQPWHGXHB-OLQVQODUSA-N |
| XLogP | 0.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5R)-3,5-dimethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3,5-dimethylpiperidin-4-one?
The IUPAC name of (3S,5R)-3,5-dimethylpiperidin-4-one (CID 100975212) is (3S,5R)-3,5-dimethylpiperidin-4-one.
What is the SMILES notation for (3S,5R)-3,5-dimethylpiperidin-4-one?
The canonical SMILES for (3S,5R)-3,5-dimethylpiperidin-4-one is C[C@@H]1CNC[C@H](C)C1=O.
What is the InChIKey of (3S,5R)-3,5-dimethylpiperidin-4-one?
The InChIKey is AMGHHWQPWHGXHB-OLQVQODUSA-N. The full InChI is InChI=1S/C7H13NO/c1-5-3-8-4-6(2)7(5)9/h5-6,8H,3-4H2,1-2H3/t5-,6+.
What are the key properties of (3S,5R)-3,5-dimethylpiperidin-4-one?
(3S,5R)-3,5-dimethylpiperidin-4-one has a molecular weight of 127.19 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3,5-dimethylpiperidin-4-one is sourced from PubChem (CID 100975212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).