C27H35NO5 — CID 100975330
N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide (PubChem CID 100975330) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide.
| Compound Name | N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 100975330 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)Cc1cc(OC2CCCCO2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C27H35NO5/c1-2-28(20-21-10-4-3-5-11-21)25(29)19-22-18-23(32-26-12-6-8-16-30-26)14-15-24(22)33-27-13-7-9-17-31-27/h3-5,10-11,14-15,18,26-27H,2,6-9,12-13,16-17,19-20H2,1H3 |
| InChIKey | MHOHPVIUHZDGPY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |