About N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide
N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide (PubChem CID 100975330) has the molecular formula C27H35NO5
and a molecular weight of 453.58 g/mol. Its IUPAC name is N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide |
| PubChem CID | 100975330 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)Cc1cc(OC2CCCCO2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C27H35NO5/c1-2-28(20-21-10-4-3-5-11-21)25(29)19-22-18-23(32-26-12-6-8-16-30-26)14-15-24(22)33-27-13-7-9-17-31-27/h3-5,10-11,14-15,18,26-27H,2,6-9,12-13,16-17,19-20H2,1H3 |
| InChIKey | MHOHPVIUHZDGPY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide?
The IUPAC name of N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide (CID 100975330) is N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide.
What is the SMILES notation for N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide?
The canonical SMILES for N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide is CCN(Cc1ccccc1)C(=O)Cc1cc(OC2CCCCO2)ccc1OC1CCCCO1.
What is the InChIKey of N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide?
The InChIKey is MHOHPVIUHZDGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35NO5/c1-2-28(20-21-10-4-3-5-11-21)25(29)19-22-18-23(32-26-12-6-8-16-30-26)14-15-24(22)33-27-13-7-9-17-31-27/h3-5,10-11,14-15,18,26-27H,2,6-9,12-13,16-17,19-20H2,1H3.
What are the key properties of N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide?
N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide has a molecular weight of 453.58 g/mol, XLogP of 5.09, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[2,5-bis(oxan-2-yloxy)phenyl]-N-ethylacetamide is sourced from PubChem (CID 100975330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).