C25H26F3N5O3 — CID 10097539
(2S)-2-methyl-6-nitro-2-[[4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 10097539) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is (2S)-2-methyl-6-nitro-2-[[4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-methyl-6-nitro-2-[[4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 10097539 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (2S)-2-methyl-6-nitro-2-[[4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(CN2CCN(Cc3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C25H26F3N5O3/c1-24(17-32-15-22(33(34)35)29-23(32)36-24)16-31-12-10-30(11-13-31)14-18-2-4-19(5-3-18)20-6-8-21(9-7-20)25(26,27)28/h2-9,15H,10-14,16-17H2,1H3/t24-/m0/s1 |
| InChIKey | VVIPVTJEVUGSRO-DEOSSOPVSA-N |
| XLogP | 4.45 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|