C30H25F2NO4 — CID 10097540
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methyl-2-[4-(2-phenylmethoxyethyl)phenyl]benzamide (PubChem CID 10097540) has the molecular formula C30H25F2NO4 and a molecular weight of 501.53 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methyl-2-[4-(2-phenylmethoxyethyl)phenyl]benzamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methyl-2-[4-(2-phenylmethoxyethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10097540 |
| Molecular Formula | C30H25F2NO4 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methyl-2-[4-(2-phenylmethoxyethyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)c1-c1ccc(CCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H25F2NO4/c1-20-6-5-9-25(29(34)33-24-14-15-26-27(18-24)37-30(31,32)36-26)28(20)23-12-10-21(11-13-23)16-17-35-19-22-7-3-2-4-8-22/h2-15,18H,16-17,19H2,1H3,(H,33,34) |
| InChIKey | NOGZLQBWDYNOIC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|