About N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine
N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine (PubChem CID 100975842) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine |
| PubChem CID | 100975842 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine |
| SMILES | COC[C@@H]1CCCN1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-22-15-18-13-8-14-21(18)20-19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,18H,8,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | JPSPGGVAWXBSLH-SFHVURJKSA-N |
| XLogP | 3.55 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine?
The IUPAC name of N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine (CID 100975842) is N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine.
What is the SMILES notation for N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine?
The canonical SMILES for N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine is COC[C@@H]1CCCN1N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine?
The InChIKey is JPSPGGVAWXBSLH-SFHVURJKSA-N. The full InChI is InChI=1S/C19H22N2O/c1-22-15-18-13-8-14-21(18)20-19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,18H,8,13-15H2,1H3/t18-/m0/s1.
What are the key properties of N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine?
N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine has a molecular weight of 294.40 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,1-diphenylmethanimine is sourced from PubChem (CID 100975842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).