C14H10N2O4 — CID 100976843
1-[3-(2,5-dioxopyrrol-1-yl)cyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione (PubChem CID 100976843) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrol-1-yl)cyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2,5-dioxopyrrol-1-yl)cyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 100976843 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrol-1-yl)cyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1=CCCC(N2C(=O)C=CC2=O)=C1 |
| InChI | InChI=1S/C14H10N2O4/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20/h2,4-8H,1,3H2 |
| InChIKey | BKHFRWYYZFFCOR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|