C13H18 — CID 100977404
[(1S,2R)-2-butan-2-ylcyclopropyl]benzene (PubChem CID 100977404) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is [(1S,2R)-2-butan-2-ylcyclopropyl]benzene.
| Compound Name | [(1S,2R)-2-butan-2-ylcyclopropyl]benzene |
|---|---|
| PubChem CID | 100977404 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | [(1S,2R)-2-butan-2-ylcyclopropyl]benzene |
| SMILES | CCC(C)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H18/c1-3-10(2)12-9-13(12)11-7-5-4-6-8-11/h4-8,10,12-13H,3,9H2,1-2H3/t10?,12-,13-/m1/s1 |
| InChIKey | DGGXNVSHCNLOQJ-SKVSWLLESA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |