C12H18N2O2 — CID 100977875
(1R,7S,10S)-3,9-diazatricyclo[8.4.0.03,7]tetradecane-2,8-dione (PubChem CID 100977875) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (1R,7S,10S)-3,9-diazatricyclo[8.4.0.03,7]tetradecane-2,8-dione.
| Compound Name | (1R,7S,10S)-3,9-diazatricyclo[8.4.0.03,7]tetradecane-2,8-dione |
|---|---|
| PubChem CID | 100977875 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (1R,7S,10S)-3,9-diazatricyclo[8.4.0.03,7]tetradecane-2,8-dione |
| SMILES | O=C1N[C@H]2CCCC[C@H]2C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C12H18N2O2/c15-11-10-6-3-7-14(10)12(16)8-4-1-2-5-9(8)13-11/h8-10H,1-7H2,(H,13,15)/t8-,9+,10+/m1/s1 |
| InChIKey | GPOLQBRXKGQVIX-UTLUCORTSA-N |
| XLogP | 0.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |