C17H9ClN4O3 — CID 1009779
4-chloro-N-[4-(2,2-dicyanoethenyl)phenyl]-3-nitrobenzamide (PubChem CID 1009779) has the molecular formula C17H9ClN4O3 and a molecular weight of 352.74 g/mol. Its IUPAC name is 4-chloro-N-[4-(2,2-dicyanoethenyl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[4-(2,2-dicyanoethenyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1009779 |
| Molecular Formula | C17H9ClN4O3 |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-chloro-N-[4-(2,2-dicyanoethenyl)phenyl]-3-nitrobenzamide |
| SMILES | N#CC(C#N)=Cc1ccc(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H9ClN4O3/c18-15-6-3-13(8-16(15)22(24)25)17(23)21-14-4-1-11(2-5-14)7-12(9-19)10-20/h1-8H,(H,21,23) |
| InChIKey | FGJIMHMESDXYPI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|