C9H11F8NO2 — CID 100977959
N,N-diethyl-2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetamide (PubChem CID 100977959) has the molecular formula C9H11F8NO2 and a molecular weight of 317.18 g/mol. Its IUPAC name is N,N-diethyl-2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetamide.
| Compound Name | N,N-diethyl-2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 100977959 |
| Molecular Formula | C9H11F8NO2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N,N-diethyl-2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetamide |
| SMILES | CCN(CC)C(=O)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F8NO2/c1-3-18(4-2)6(19)5(10)20-9(16,17)7(11,12)8(13,14)15/h5H,3-4H2,1-2H3 |
| InChIKey | DWUDAJXPPUBFMZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|