C8H9F8NO2 — CID 100977963
2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-propylacetamide (PubChem CID 100977963) has the molecular formula C8H9F8NO2 and a molecular weight of 303.15 g/mol. Its IUPAC name is 2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-propylacetamide.
| Compound Name | 2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-propylacetamide |
|---|---|
| PubChem CID | 100977963 |
| Molecular Formula | C8H9F8NO2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-propylacetamide |
| SMILES | CCCNC(=O)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F8NO2/c1-2-3-17-5(18)4(9)19-8(15,16)6(10,11)7(12,13)14/h4H,2-3H2,1H3,(H,17,18) |
| InChIKey | GFLLDXTUEUTUFF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|