C39H30N6 — CID 100977967
2,4,6-tris[4-(pyridin-4-ylmethyl)phenyl]-1,3,5-triazine (PubChem CID 100977967) has the molecular formula C39H30N6 and a molecular weight of 582.71 g/mol. Its IUPAC name is 2,4,6-tris[4-(pyridin-4-ylmethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-(pyridin-4-ylmethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 100977967 |
| Molecular Formula | C39H30N6 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 2,4,6-tris[4-(pyridin-4-ylmethyl)phenyl]-1,3,5-triazine |
| SMILES | c1cc(Cc2ccc(-c3nc(-c4ccc(Cc5ccncc5)cc4)nc(-c4ccc(Cc5ccncc5)cc4)n3)cc2)ccn1 |
| InChI | InChI=1S/C39H30N6/c1-7-34(8-2-28(1)25-31-13-19-40-20-14-31)37-43-38(35-9-3-29(4-10-35)26-32-15-21-41-22-16-32)45-39(44-37)36-11-5-30(6-12-36)27-33-17-23-42-24-18-33/h1-24H,25-27H2 |
| InChIKey | WPRUMGNXLBANJC-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |