C32H46N2O6 — CID 100978321
4-[4-(dibutylamino)-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene]-2-[4-(dibutylamino)-2,6-dihydroxyphenyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 100978321) has the molecular formula C32H46N2O6 and a molecular weight of 554.73 g/mol. Its IUPAC name is 4-[4-(dibutylamino)-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene]-2-[4-(dibutylamino)-2,6-dihydroxyphenyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[4-(dibutylamino)-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene]-2-[4-(dibutylamino)-2,6-dihydroxyphenyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 100978321 |
| Molecular Formula | C32H46N2O6 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 4-[4-(dibutylamino)-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene]-2-[4-(dibutylamino)-2,6-dihydroxyphenyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCN(CCCC)c1cc(O)c(C2=C(O)C(=C3C(O)=CC(N(CCCC)CCCC)C=C3O)C2=O)c(O)c1 |
| InChI | InChI=1S/C32H46N2O6/c1-5-9-13-33(14-10-6-2)21-17-23(35)27(24(36)18-21)29-31(39)30(32(29)40)28-25(37)19-22(20-26(28)38)34(15-11-7-3)16-12-8-4/h17-21,35-39H,5-16H2,1-4H3/b29-27- |
| InChIKey | OYTNRBURXLPACG-OHYPFYFLSA-N |
| XLogP | 6.82 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|