C20H26N2 — CID 100978350
3-carbazol-9-yl-N,N-diethyl-2-methylpropan-1-amine (PubChem CID 100978350) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-carbazol-9-yl-N,N-diethyl-2-methylpropan-1-amine.
| Compound Name | 3-carbazol-9-yl-N,N-diethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 100978350 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-carbazol-9-yl-N,N-diethyl-2-methylpropan-1-amine |
| SMILES | CCN(CC)CC(C)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C20H26N2/c1-4-21(5-2)14-16(3)15-22-19-12-8-6-10-17(19)18-11-7-9-13-20(18)22/h6-13,16H,4-5,14-15H2,1-3H3 |
| InChIKey | KHZHPAWLIYJDCF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |