C21H25NO2 — CID 100978811
ethyl (2R,3R)-1-benzhydryl-3-propylaziridine-2-carboxylate (PubChem CID 100978811) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzhydryl-3-propylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzhydryl-3-propylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 100978811 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | ethyl (2R,3R)-1-benzhydryl-3-propylaziridine-2-carboxylate |
| SMILES | CCC[C@@H]1[C@H](C(=O)OCC)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-3-11-18-20(21(23)24-4-2)22(18)19(16-12-7-5-8-13-16)17-14-9-6-10-15-17/h5-10,12-15,18-20H,3-4,11H2,1-2H3/t18-,20-,22?/m1/s1 |
| InChIKey | FMOUIZGXPASHLH-CJHNXZANSA-N |
| XLogP | 4.19 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|