C22H40O7Si2 — CID 100978935
methyl (1S,5R,6S,7S,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 100978935) has the molecular formula C22H40O7Si2 and a molecular weight of 472.73 g/mol. Its IUPAC name is methyl (1S,5R,6S,7S,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | methyl (1S,5R,6S,7S,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 100978935 |
| Molecular Formula | C22H40O7Si2 |
| Molecular Weight | 472.73 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | methyl (1S,5R,6S,7S,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2O[C@@]3(COC(=O)[C@H]13)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O7Si2/c1-20(2,3)30(8,9)28-16-15-13(18(23)25-7)14-19(24)26-12-22(14,27-15)17(16)29-31(10,11)21(4,5)6/h13-17H,12H2,1-11H3/t13-,14-,15-,16-,17-,22+/m0/s1 |
| InChIKey | QOLLZMUCHXXTIN-ZWBPQZFFSA-N |
| XLogP | 3.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|