C22H44N2O11 — CID 10097927
(2R,3S,4S,5R,6R)-2-[2-(1-hydroxybutan-2-ylamino)ethyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[2-(1-hydroxybutan-2-ylamino)ethyl]oxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 10097927) has the molecular formula C22H44N2O11 and a molecular weight of 512.60 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[2-(1-hydroxybutan-2-ylamino)ethyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[2-(1-hydroxybutan-2-ylamino)ethyl]oxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[2-(1-hydroxybutan-2-ylamino)ethyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[2-(1-hydroxybutan-2-ylamino)ethyl]oxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10097927 |
| Molecular Formula | C22H44N2O11 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[2-(1-hydroxybutan-2-ylamino)ethyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[2-(1-hydroxybutan-2-ylamino)ethyl]oxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCC(CO)NCC[C@H]1O[C@H](O[C@H]2O[C@H](CCNC(CC)CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H44N2O11/c1-3-11(9-25)23-7-5-13-15(27)17(29)19(31)21(33-13)35-22-20(32)18(30)16(28)14(34-22)6-8-24-12(4-2)10-26/h11-32H,3-10H2,1-2H3/t11?,12?,13-,14-,15-,16-,17+,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | CNBZKTNWZZABHM-YYLCLCFCSA-N |
| XLogP | -3.88 |
| TPSA | 213.59 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |