About O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate
O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate (PubChem CID 100979352) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate |
| PubChem CID | 100979352 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate |
| SMILES | CC/C=C/[C@H](CC)OC(=S)NC |
| InChI | InChI=1S/C9H17NOS/c1-4-6-7-8(5-2)11-9(12)10-3/h6-8H,4-5H2,1-3H3,(H,10,12)/b7-6+/t8-/m0/s1 |
| InChIKey | FYHHUBKWAFWYAA-CZEYKFRCSA-N |
| XLogP | 2.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate?
The IUPAC name of O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate (CID 100979352) is O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate.
What is the SMILES notation for O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate?
The canonical SMILES for O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate is CC/C=C/[C@H](CC)OC(=S)NC.
What is the InChIKey of O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate?
The InChIKey is FYHHUBKWAFWYAA-CZEYKFRCSA-N. The full InChI is InChI=1S/C9H17NOS/c1-4-6-7-8(5-2)11-9(12)10-3/h6-8H,4-5H2,1-3H3,(H,10,12)/b7-6+/t8-/m0/s1.
What are the key properties of O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate?
O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate has a molecular weight of 187.31 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(E,3S)-hept-4-en-3-yl] N-methylcarbamothioate is sourced from PubChem (CID 100979352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).