C26H16O4 — CID 100979433
7,7-bis(4-hydroxyphenyl)-6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaen-5-one (PubChem CID 100979433) has the molecular formula C26H16O4 and a molecular weight of 392.41 g/mol. Its IUPAC name is 7,7-bis(4-hydroxyphenyl)-6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaen-5-one.
| Compound Name | 7,7-bis(4-hydroxyphenyl)-6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaen-5-one |
|---|---|
| PubChem CID | 100979433 |
| Molecular Formula | C26H16O4 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 7,7-bis(4-hydroxyphenyl)-6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaen-5-one |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccc3c4c(ccc1c24)C=C3 |
| InChI | InChI=1S/C26H16O4/c27-19-9-5-17(6-10-19)26(18-7-11-20(28)12-8-18)22-14-4-16-2-1-15-3-13-21(25(29)30-26)24(22)23(15)16/h1-14,27-28H |
| InChIKey | HAPKRXMVUFFERK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |