C44H44N4O6 — CID 100979925
6,16-dioxa-23,30,40,47-tetrazaheptacyclo[43.3.1.121,25.05,48.017,22.024,29.041,46]pentaconta-1(48),2,4,17,19,21,23,25(50),26,28,41,43,45(49),46-tetradecaene-7,15,31,39-tetrone (PubChem CID 100979925) has the molecular formula C44H44N4O6 and a molecular weight of 724.86 g/mol. Its IUPAC name is 6,16-dioxa-23,30,40,47-tetrazaheptacyclo[43.3.1.121,25.05,48.017,22.024,29.041,46]pentaconta-1(48),2,4,17,19,21,23,25(50),26,28,41,43,45(49),46-tetradecaene-7,15,31,39-tetrone.
| Compound Name | 6,16-dioxa-23,30,40,47-tetrazaheptacyclo[43.3.1.121,25.05,48.017,22.024,29.041,46]pentaconta-1(48),2,4,17,19,21,23,25(50),26,28,41,43,45(49),46-tetradecaene-7,15,31,39-tetrone |
|---|---|
| PubChem CID | 100979925 |
| Molecular Formula | C44H44N4O6 |
| Molecular Weight | 724.86 g/mol |
| Exact Mass | 724.33 |
| IUPAC Name | 6,16-dioxa-23,30,40,47-tetrazaheptacyclo[43.3.1.121,25.05,48.017,22.024,29.041,46]pentaconta-1(48),2,4,17,19,21,23,25(50),26,28,41,43,45(49),46-tetradecaene-7,15,31,39-tetrone |
| SMILES | O=C1CCCCCCCC(=O)Nc2cccc3cc4cccc(c4nc23)OC(=O)CCCCCCCC(=O)Oc2cccc3cc4cccc(c4nc23)N1 |
| InChI | InChI=1S/C44H44N4O6/c49-37-23-7-3-1-4-8-24-38(50)46-34-20-12-16-30-28-32-18-14-22-36(44(32)48-42(30)34)54-40(52)26-10-6-2-5-9-25-39(51)53-35-21-13-17-31-27-29-15-11-19-33(45-37)41(29)47-43(31)35/h11-22,27-28H,1-10,23-26H2,(H,45,49)(H,46,50) |
| InChIKey | IRHLLGGSUXFJQX-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.86 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|