C17H24O4 — CID 100980007
(1E,3Z,6R,7R)-6-(2-carboxyethyl)-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylic acid (PubChem CID 100980007) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1E,3Z,6R,7R)-6-(2-carboxyethyl)-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylic acid.
| Compound Name | (1E,3Z,6R,7R)-6-(2-carboxyethyl)-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 100980007 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1E,3Z,6R,7R)-6-(2-carboxyethyl)-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylic acid |
| SMILES | C=C1CC[C@@H](C)[C@](C)(CCC(=O)O)C/C=C\C=C/1C(=O)O |
| InChI | InChI=1S/C17H24O4/c1-12-7-8-13(2)17(3,11-9-15(18)19)10-5-4-6-14(12)16(20)21/h4-6,13H,1,7-11H2,2-3H3,(H,18,19)(H,20,21)/b5-4-,14-6+/t13-,17+/m1/s1 |
| InChIKey | REJAAYKOPDSYHA-CGYOTGJGSA-N |
| XLogP | 3.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |