C22H33NO2 — CID 100980298
(1S,5R)-3-(4-butylphenyl)-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carboxylic acid (PubChem CID 100980298) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1S,5R)-3-(4-butylphenyl)-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carboxylic acid.
| Compound Name | (1S,5R)-3-(4-butylphenyl)-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carboxylic acid |
|---|---|
| PubChem CID | 100980298 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (1S,5R)-3-(4-butylphenyl)-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carboxylic acid |
| SMILES | CCCCc1ccc(N2C[C@@]3(C)CC(C)(C(=O)O)C[C@@](C)(C2)C3)cc1 |
| InChI | InChI=1S/C22H33NO2/c1-5-6-7-17-8-10-18(11-9-17)23-15-20(2)12-21(3,16-23)14-22(4,13-20)19(24)25/h8-11H,5-7,12-16H2,1-4H3,(H,24,25)/t20-,21+,22? |
| InChIKey | JDXIQVBQKOZZRW-CBQGHPETSA-N |
| XLogP | 5.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|